About 6-[(1-phenylimidazo[4,5-b]pyridin-2-yl)methylsulfanyl]-7H-purine
6-[(1-phenylimidazo[4,5-b]pyridin-2-yl)methylsulfanyl]-7H-purine (PubChem CID 70922613) has the molecular formula C18H13N7S
and a molecular weight of 359.42 g/mol. Its IUPAC name is 6-[(1-phenylimidazo[4,5-b]pyridin-2-yl)methylsulfanyl]-7H-purine.
Molecular Properties
| Compound Name | 6-[(1-phenylimidazo[4,5-b]pyridin-2-yl)methylsulfanyl]-7H-purine |
| PubChem CID | 70922613 |
| Molecular Formula | C18H13N7S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 6-[(1-phenylimidazo[4,5-b]pyridin-2-yl)methylsulfanyl]-7H-purine |
| SMILES | c1ccc(-n2c(CSc3ncnc4nc[nH]c34)nc3ncccc32)cc1 |
| InChI | InChI=1S/C18H13N7S/c1-2-5-12(6-3-1)25-13-7-4-8-19-16(13)24-14(25)9-26-18-15-17(21-10-20-15)22-11-23-18/h1-8,10-11H,9H2,(H,20,21,22,23) |
| InChIKey | PFBPFZQCTPJICH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[(1-phenylimidazo[4,5-b]pyridin-2-yl)methylsulfanyl]-7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1-phenylimidazo[4,5-b]pyridin-2-yl)methylsulfanyl]-7H-purine?
The IUPAC name of 6-[(1-phenylimidazo[4,5-b]pyridin-2-yl)methylsulfanyl]-7H-purine (CID 70922613) is 6-[(1-phenylimidazo[4,5-b]pyridin-2-yl)methylsulfanyl]-7H-purine.
What is the SMILES notation for 6-[(1-phenylimidazo[4,5-b]pyridin-2-yl)methylsulfanyl]-7H-purine?
The canonical SMILES for 6-[(1-phenylimidazo[4,5-b]pyridin-2-yl)methylsulfanyl]-7H-purine is c1ccc(-n2c(CSc3ncnc4nc[nH]c34)nc3ncccc32)cc1.
What is the InChIKey of 6-[(1-phenylimidazo[4,5-b]pyridin-2-yl)methylsulfanyl]-7H-purine?
The InChIKey is PFBPFZQCTPJICH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N7S/c1-2-5-12(6-3-1)25-13-7-4-8-19-16(13)24-14(25)9-26-18-15-17(21-10-20-15)22-11-23-18/h1-8,10-11H,9H2,(H,20,21,22,23).
What are the key properties of 6-[(1-phenylimidazo[4,5-b]pyridin-2-yl)methylsulfanyl]-7H-purine?
6-[(1-phenylimidazo[4,5-b]pyridin-2-yl)methylsulfanyl]-7H-purine has a molecular weight of 359.42 g/mol, XLogP of 3.38, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1-phenylimidazo[4,5-b]pyridin-2-yl)methylsulfanyl]-7H-purine is sourced from PubChem (CID 70922613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).