C19H18N4S — CID 709233
(13R)-13-methyl-5-(4-methylphenyl)-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 709233) has the molecular formula C19H18N4S and a molecular weight of 334.45 g/mol. Its IUPAC name is (13R)-13-methyl-5-(4-methylphenyl)-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | (13R)-13-methyl-5-(4-methylphenyl)-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 709233 |
| Molecular Formula | C19H18N4S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (13R)-13-methyl-5-(4-methylphenyl)-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | Cc1ccc(-c2nnc3c4c5c(sc4ncn23)C[C@H](C)CC5)cc1 |
| InChI | InChI=1S/C19H18N4S/c1-11-3-6-13(7-4-11)17-21-22-18-16-14-8-5-12(2)9-15(14)24-19(16)20-10-23(17)18/h3-4,6-7,10,12H,5,8-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | VIJRHHOOSJBKKL-GFCCVEGCSA-N |
| XLogP | 4.44 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |