C33H42N6O — CID 70924193
2,2-dimethyl-1-[4-[3-[9H-pyrido[3,4-b]indol-1-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]propyl]piperazin-1-yl]propan-1-one (PubChem CID 70924193) has the molecular formula C33H42N6O and a molecular weight of 538.74 g/mol. Its IUPAC name is 2,2-dimethyl-1-[4-[3-[9H-pyrido[3,4-b]indol-1-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]propyl]piperazin-1-yl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[4-[3-[9H-pyrido[3,4-b]indol-1-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]propyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 70924193 |
| Molecular Formula | C33H42N6O |
| Molecular Weight | 538.74 g/mol |
| Exact Mass | 538.34 |
| IUPAC Name | 2,2-dimethyl-1-[4-[3-[9H-pyrido[3,4-b]indol-1-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]propyl]piperazin-1-yl]propan-1-one |
| SMILES | CC(C)(C)C(=O)N1CCN(CCCN(Cc2nccc3c2[nH]c2ccccc23)C2CCCc3cccnc32)CC1 |
| InChI | InChI=1S/C33H42N6O/c1-33(2,3)32(40)38-21-19-37(20-22-38)17-8-18-39(29-13-6-9-24-10-7-15-35-30(24)29)23-28-31-26(14-16-34-28)25-11-4-5-12-27(25)36-31/h4-5,7,10-12,14-16,29,36H,6,8-9,13,17-23H2,1-3H3 |
| InChIKey | JMPGXUGRSGZPNC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.74 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |