C31H41N7 — CID 70924198
N'-[[9-(2-piperazin-1-ylethyl)pyrido[3,4-b]indol-1-yl]methyl]-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine (PubChem CID 70924198) has the molecular formula C31H41N7 and a molecular weight of 511.72 g/mol. Its IUPAC name is N'-[[9-(2-piperazin-1-ylethyl)pyrido[3,4-b]indol-1-yl]methyl]-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine.
| Compound Name | N'-[[9-(2-piperazin-1-ylethyl)pyrido[3,4-b]indol-1-yl]methyl]-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 70924198 |
| Molecular Formula | C31H41N7 |
| Molecular Weight | 511.72 g/mol |
| Exact Mass | 511.34 |
| IUPAC Name | N'-[[9-(2-piperazin-1-ylethyl)pyrido[3,4-b]indol-1-yl]methyl]-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine |
| SMILES | NCCCCN(Cc1nccc2c3ccccc3n(CCN3CCNCC3)c12)[C@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C31H41N7/c32-13-3-4-18-37(29-11-5-7-24-8-6-14-35-30(24)29)23-27-31-26(12-15-34-27)25-9-1-2-10-28(25)38(31)22-21-36-19-16-33-17-20-36/h1-2,6,8-10,12,14-15,29,33H,3-5,7,11,13,16-23,32H2/t29-/m0/s1 |
| InChIKey | UVLUSKOWWGCJCZ-LJAQVGFWSA-N |
| XLogP | 4.11 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.72 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|