C31H29N3O7 — CID 70924328
(4R,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-5a-methyl-3,12-dioxo-7-quinolin-3-yl-4,4a,5,6-tetrahydrotetracene-2-carboxamide (PubChem CID 70924328) has the molecular formula C31H29N3O7 and a molecular weight of 555.59 g/mol. Its IUPAC name is (4R,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-5a-methyl-3,12-dioxo-7-quinolin-3-yl-4,4a,5,6-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-5a-methyl-3,12-dioxo-7-quinolin-3-yl-4,4a,5,6-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 70924328 |
| Molecular Formula | C31H29N3O7 |
| Molecular Weight | 555.59 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | (4R,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-5a-methyl-3,12-dioxo-7-quinolin-3-yl-4,4a,5,6-tetrahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5cnc6ccccc6c5)c4C[C@@]3(C)C[C@@H]12 |
| InChI | InChI=1S/C31H29N3O7/c1-30-11-17-16(15-10-14-6-4-5-7-19(14)33-13-15)8-9-20(35)21(17)25(36)23(30)28(39)31(41)18(12-30)24(34(2)3)26(37)22(27(31)38)29(32)40/h4-10,13,18,24,35-36,38,41H,11-12H2,1-3H3,(H2,32,40)/t18-,24+,30-,31+/m0/s1 |
| InChIKey | HDYFXTRFFMQMCI-RZPVVIRLSA-N |
| XLogP | 2.57 |
| TPSA | 174.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.59 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|