About N-(2-methyl-6-propylcyclohepta-1,4,6-trien-1-yl)acetamide
N-(2-methyl-6-propylcyclohepta-1,4,6-trien-1-yl)acetamide (PubChem CID 70924617) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is N-(2-methyl-6-propylcyclohepta-1,4,6-trien-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-methyl-6-propylcyclohepta-1,4,6-trien-1-yl)acetamide |
| PubChem CID | 70924617 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | N-(2-methyl-6-propylcyclohepta-1,4,6-trien-1-yl)acetamide |
| SMILES | CCCC1=CC(NC(C)=O)=C(C)CC=C1 |
| InChI | InChI=1S/C13H19NO/c1-4-6-12-8-5-7-10(2)13(9-12)14-11(3)15/h5,8-9H,4,6-7H2,1-3H3,(H,14,15) |
| InChIKey | WBQZQIMQLHPIGW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2-methyl-6-propylcyclohepta-1,4,6-trien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methyl-6-propylcyclohepta-1,4,6-trien-1-yl)acetamide?
The IUPAC name of N-(2-methyl-6-propylcyclohepta-1,4,6-trien-1-yl)acetamide (CID 70924617) is N-(2-methyl-6-propylcyclohepta-1,4,6-trien-1-yl)acetamide.
What is the SMILES notation for N-(2-methyl-6-propylcyclohepta-1,4,6-trien-1-yl)acetamide?
The canonical SMILES for N-(2-methyl-6-propylcyclohepta-1,4,6-trien-1-yl)acetamide is CCCC1=CC(NC(C)=O)=C(C)CC=C1.
What is the InChIKey of N-(2-methyl-6-propylcyclohepta-1,4,6-trien-1-yl)acetamide?
The InChIKey is WBQZQIMQLHPIGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-4-6-12-8-5-7-10(2)13(9-12)14-11(3)15/h5,8-9H,4,6-7H2,1-3H3,(H,14,15).
What are the key properties of N-(2-methyl-6-propylcyclohepta-1,4,6-trien-1-yl)acetamide?
N-(2-methyl-6-propylcyclohepta-1,4,6-trien-1-yl)acetamide has a molecular weight of 205.30 g/mol, XLogP of 3.08, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methyl-6-propylcyclohepta-1,4,6-trien-1-yl)acetamide is sourced from PubChem (CID 70924617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).