C27H28F3N3O3S — CID 70925127
5-(3-ethylsulfonylphenyl)-3,8-dimethyl-N-(5,5,5-trifluoropentyl)-9H-pyrido[2,3-b]indole-7-carboxamide (PubChem CID 70925127) has the molecular formula C27H28F3N3O3S and a molecular weight of 531.60 g/mol. Its IUPAC name is 5-(3-ethylsulfonylphenyl)-3,8-dimethyl-N-(5,5,5-trifluoropentyl)-9H-pyrido[2,3-b]indole-7-carboxamide.
| Compound Name | 5-(3-ethylsulfonylphenyl)-3,8-dimethyl-N-(5,5,5-trifluoropentyl)-9H-pyrido[2,3-b]indole-7-carboxamide |
|---|---|
| PubChem CID | 70925127 |
| Molecular Formula | C27H28F3N3O3S |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 5-(3-ethylsulfonylphenyl)-3,8-dimethyl-N-(5,5,5-trifluoropentyl)-9H-pyrido[2,3-b]indole-7-carboxamide |
| SMILES | CCS(=O)(=O)c1cccc(-c2cc(C(=O)NCCCCC(F)(F)F)c(C)c3[nH]c4ncc(C)cc4c23)c1 |
| InChI | InChI=1S/C27H28F3N3O3S/c1-4-37(35,36)19-9-7-8-18(13-19)21-14-20(26(34)31-11-6-5-10-27(28,29)30)17(3)24-23(21)22-12-16(2)15-32-25(22)33-24/h7-9,12-15H,4-6,10-11H2,1-3H3,(H,31,34)(H,32,33) |
| InChIKey | OBERMEYFZOFURU-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|