About 5-(1,3-benzodioxol-5-yl)-3-(3-fluoro-2-pyridinyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one
5-(1,3-benzodioxol-5-yl)-3-(3-fluoro-2-pyridinyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 70925357) has the molecular formula C18H11FN4O3
and a molecular weight of 350.31 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-3-(3-fluoro-2-pyridinyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5-(1,3-benzodioxol-5-yl)-3-(3-fluoro-2-pyridinyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 70925357 |
| Molecular Formula | C18H11FN4O3 |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-3-(3-fluoro-2-pyridinyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | O=c1cc(-c2ccc3c(c2)OCO3)nc2c(-c3ncccc3F)c[nH]n12 |
| InChI | InChI=1S/C18H11FN4O3/c19-12-2-1-5-20-17(12)11-8-21-23-16(24)7-13(22-18(11)23)10-3-4-14-15(6-10)26-9-25-14/h1-8,21H,9H2 |
| InChIKey | CWPDXXSDFWFMNK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(1,3-benzodioxol-5-yl)-3-(3-fluoro-2-pyridinyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-benzodioxol-5-yl)-3-(3-fluoro-2-pyridinyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 5-(1,3-benzodioxol-5-yl)-3-(3-fluoro-2-pyridinyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 70925357) is 5-(1,3-benzodioxol-5-yl)-3-(3-fluoro-2-pyridinyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 5-(1,3-benzodioxol-5-yl)-3-(3-fluoro-2-pyridinyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 5-(1,3-benzodioxol-5-yl)-3-(3-fluoro-2-pyridinyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one is O=c1cc(-c2ccc3c(c2)OCO3)nc2c(-c3ncccc3F)c[nH]n12.
What is the InChIKey of 5-(1,3-benzodioxol-5-yl)-3-(3-fluoro-2-pyridinyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is CWPDXXSDFWFMNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11FN4O3/c19-12-2-1-5-20-17(12)11-8-21-23-16(24)7-13(22-18(11)23)10-3-4-14-15(6-10)26-9-25-14/h1-8,21H,9H2.
What are the key properties of 5-(1,3-benzodioxol-5-yl)-3-(3-fluoro-2-pyridinyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one?
5-(1,3-benzodioxol-5-yl)-3-(3-fluoro-2-pyridinyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 350.31 g/mol, XLogP of 2.62, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-benzodioxol-5-yl)-3-(3-fluoro-2-pyridinyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 70925357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).