C16H14O6 — CID 70925392
2,2-dimethyl-5-(3-methyl-1-benzofuran-5-carbonyl)-1,3-dioxane-4,6-dione (PubChem CID 70925392) has the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. Its IUPAC name is 2,2-dimethyl-5-(3-methyl-1-benzofuran-5-carbonyl)-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-(3-methyl-1-benzofuran-5-carbonyl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 70925392 |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2,2-dimethyl-5-(3-methyl-1-benzofuran-5-carbonyl)-1,3-dioxane-4,6-dione |
| SMILES | Cc1coc2ccc(C(=O)C3C(=O)OC(C)(C)OC3=O)cc12 |
| InChI | InChI=1S/C16H14O6/c1-8-7-20-11-5-4-9(6-10(8)11)13(17)12-14(18)21-16(2,3)22-15(12)19/h4-7,12H,1-3H3 |
| InChIKey | URMHJLXXGLGOIC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|