C20H16N4O2 — CID 70925452
5-methoxy-15-pyridin-2-yl-12,13,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2(7),3,5,14,16-hexaen-11-one (PubChem CID 70925452) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is 5-methoxy-15-pyridin-2-yl-12,13,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2(7),3,5,14,16-hexaen-11-one.
| Compound Name | 5-methoxy-15-pyridin-2-yl-12,13,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2(7),3,5,14,16-hexaen-11-one |
|---|---|
| PubChem CID | 70925452 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 5-methoxy-15-pyridin-2-yl-12,13,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2(7),3,5,14,16-hexaen-11-one |
| SMILES | COc1ccc2c(c1)CCc1c-2nc2c(-c3ccccn3)c[nH]n2c1=O |
| InChI | InChI=1S/C20H16N4O2/c1-26-13-6-8-14-12(10-13)5-7-15-18(14)23-19-16(11-22-24(19)20(15)25)17-4-2-3-9-21-17/h2-4,6,8-11,22H,5,7H2,1H3 |
| InChIKey | MMTSHQAKZLEIJH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |