C19H14N4O — CID 70925463
15-pyridin-2-yl-12,13,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,14,16-hexaen-11-one (PubChem CID 70925463) has the molecular formula C19H14N4O and a molecular weight of 314.35 g/mol. Its IUPAC name is 15-pyridin-2-yl-12,13,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,14,16-hexaen-11-one.
| Compound Name | 15-pyridin-2-yl-12,13,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,14,16-hexaen-11-one |
|---|---|
| PubChem CID | 70925463 |
| Molecular Formula | C19H14N4O |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 15-pyridin-2-yl-12,13,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,14,16-hexaen-11-one |
| SMILES | O=c1c2c(nc3c(-c4ccccn4)c[nH]n13)-c1ccccc1CC2 |
| InChI | InChI=1S/C19H14N4O/c24-19-14-9-8-12-5-1-2-6-13(12)17(14)22-18-15(11-21-23(18)19)16-7-3-4-10-20-16/h1-7,10-11,21H,8-9H2 |
| InChIKey | LUAZMSZXBRIORH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |