C24H42O6 — CID 70925701
bis(4-tert-butylcyclohexyl) (2R,3R)-2,3-dihydroxybutanedioate (PubChem CID 70925701) has the molecular formula C24H42O6 and a molecular weight of 426.59 g/mol. Its IUPAC name is bis(4-tert-butylcyclohexyl) (2R,3R)-2,3-dihydroxybutanedioate.
| Compound Name | bis(4-tert-butylcyclohexyl) (2R,3R)-2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 70925701 |
| Molecular Formula | C24H42O6 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | bis(4-tert-butylcyclohexyl) (2R,3R)-2,3-dihydroxybutanedioate |
| SMILES | CC(C)(C)C1CCC(OC(=O)[C@H](O)[C@@H](O)C(=O)OC2CCC(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C24H42O6/c1-23(2,3)15-7-11-17(12-8-15)29-21(27)19(25)20(26)22(28)30-18-13-9-16(10-14-18)24(4,5)6/h15-20,25-26H,7-14H2,1-6H3/t15?,16?,17?,18?,19-,20-/m1/s1 |
| InChIKey | UEGYLOJHKXCEOT-MHUBRMLGSA-N |
| XLogP | 4.00 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |