C17H24O4 — CID 70926060
dipropan-2-yl 5,6-dimethylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 70926060) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is dipropan-2-yl 5,6-dimethylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | dipropan-2-yl 5,6-dimethylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 70926060 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | dipropan-2-yl 5,6-dimethylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | CC1=C(C)C2CC1C(C(=O)OC(C)C)=C2C(=O)OC(C)C |
| InChI | InChI=1S/C17H24O4/c1-8(2)20-16(18)14-12-7-13(11(6)10(12)5)15(14)17(19)21-9(3)4/h8-9,12-13H,7H2,1-6H3 |
| InChIKey | VOWYQETXUWHPTQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|