About (3R)-3-tert-butyl-4-methyl-2H-1,3-benzoxaphosphole
(3R)-3-tert-butyl-4-methyl-2H-1,3-benzoxaphosphole (PubChem CID 70926228) has the molecular formula C12H17OP
and a molecular weight of 208.24 g/mol. Its IUPAC name is (3R)-3-tert-butyl-4-methyl-2H-1,3-benzoxaphosphole.
Molecular Properties
| Compound Name | (3R)-3-tert-butyl-4-methyl-2H-1,3-benzoxaphosphole |
| PubChem CID | 70926228 |
| Molecular Formula | C12H17OP |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | (3R)-3-tert-butyl-4-methyl-2H-1,3-benzoxaphosphole |
| SMILES | Cc1cccc2c1[P@@](C(C)(C)C)CO2 |
| InChI | InChI=1S/C12H17OP/c1-9-6-5-7-10-11(9)14(8-13-10)12(2,3)4/h5-7H,8H2,1-4H3/t14-/m0/s1 |
| InChIKey | IAUBNIQITXXITE-AWEZNQCLSA-N |
| XLogP | 3.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-tert-butyl-4-methyl-2H-1,3-benzoxaphosphole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-tert-butyl-4-methyl-2H-1,3-benzoxaphosphole?
The IUPAC name of (3R)-3-tert-butyl-4-methyl-2H-1,3-benzoxaphosphole (CID 70926228) is (3R)-3-tert-butyl-4-methyl-2H-1,3-benzoxaphosphole.
What is the SMILES notation for (3R)-3-tert-butyl-4-methyl-2H-1,3-benzoxaphosphole?
The canonical SMILES for (3R)-3-tert-butyl-4-methyl-2H-1,3-benzoxaphosphole is Cc1cccc2c1[P@@](C(C)(C)C)CO2.
What is the InChIKey of (3R)-3-tert-butyl-4-methyl-2H-1,3-benzoxaphosphole?
The InChIKey is IAUBNIQITXXITE-AWEZNQCLSA-N. The full InChI is InChI=1S/C12H17OP/c1-9-6-5-7-10-11(9)14(8-13-10)12(2,3)4/h5-7H,8H2,1-4H3/t14-/m0/s1.
What are the key properties of (3R)-3-tert-butyl-4-methyl-2H-1,3-benzoxaphosphole?
(3R)-3-tert-butyl-4-methyl-2H-1,3-benzoxaphosphole has a molecular weight of 208.24 g/mol, XLogP of 3.25, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-tert-butyl-4-methyl-2H-1,3-benzoxaphosphole is sourced from PubChem (CID 70926228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).