C18H18N2O2S — CID 70926295
2,4-bis[(4-methylphenyl)methyl]-1,2,4-thiadiazolidine-3,5-dione (PubChem CID 70926295) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is 2,4-bis[(4-methylphenyl)methyl]-1,2,4-thiadiazolidine-3,5-dione.
| Compound Name | 2,4-bis[(4-methylphenyl)methyl]-1,2,4-thiadiazolidine-3,5-dione |
|---|---|
| PubChem CID | 70926295 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2,4-bis[(4-methylphenyl)methyl]-1,2,4-thiadiazolidine-3,5-dione |
| SMILES | Cc1ccc(Cn2sc(=O)n(Cc3ccc(C)cc3)c2=O)cc1 |
| InChI | InChI=1S/C18H18N2O2S/c1-13-3-7-15(8-4-13)11-19-17(21)20(23-18(19)22)12-16-9-5-14(2)6-10-16/h3-10H,11-12H2,1-2H3 |
| InChIKey | QIMOYQYFRBHNDW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |