C12H12FN3O2S — CID 70926607
4-anilino-2-methylsulfanylpyrimidine-5-carboxylic acid;hydrofluoride (PubChem CID 70926607) has the molecular formula C12H12FN3O2S and a molecular weight of 281.31 g/mol. Its IUPAC name is 4-anilino-2-methylsulfanylpyrimidine-5-carboxylic acid;hydrofluoride.
| Compound Name | 4-anilino-2-methylsulfanylpyrimidine-5-carboxylic acid;hydrofluoride |
|---|---|
| PubChem CID | 70926607 |
| Molecular Formula | C12H12FN3O2S |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 4-anilino-2-methylsulfanylpyrimidine-5-carboxylic acid;hydrofluoride |
| SMILES | CSc1ncc(C(=O)O)c(Nc2ccccc2)n1.F |
| InChI | InChI=1S/C12H11N3O2S.FH/c1-18-12-13-7-9(11(16)17)10(15-12)14-8-5-3-2-4-6-8;/h2-7H,1H3,(H,16,17)(H,13,14,15);1H |
| InChIKey | UUPYBLPNCRGWSD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |