C16H20N2 — CID 70926862
7,8,8,9,9-pentamethyl-7H-cyclopenta[h]quinazoline (PubChem CID 70926862) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 7,8,8,9,9-pentamethyl-7H-cyclopenta[h]quinazoline.
| Compound Name | 7,8,8,9,9-pentamethyl-7H-cyclopenta[h]quinazoline |
|---|---|
| PubChem CID | 70926862 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 7,8,8,9,9-pentamethyl-7H-cyclopenta[h]quinazoline |
| SMILES | CC1c2ccc3cncnc3c2C(C)(C)C1(C)C |
| InChI | InChI=1S/C16H20N2/c1-10-12-7-6-11-8-17-9-18-14(11)13(12)16(4,5)15(10,2)3/h6-10H,1-5H3 |
| InChIKey | GCBOXWKDYIKDRS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |