About [4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-3-(trifluoromethyl)phenyl]methanol
[4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-3-(trifluoromethyl)phenyl]methanol (PubChem CID 70926920) has the molecular formula C22H22F3NO
and a molecular weight of 373.42 g/mol. Its IUPAC name is [4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-3-(trifluoromethyl)phenyl]methanol.
Molecular Properties
| Compound Name | [4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-3-(trifluoromethyl)phenyl]methanol |
| PubChem CID | 70926920 |
| Molecular Formula | C22H22F3NO |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | [4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-3-(trifluoromethyl)phenyl]methanol |
| SMILES | OCc1ccc(CN2CCC3(C=Cc4ccccc43)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H22F3NO/c23-22(24,25)20-13-16(15-27)5-6-18(20)14-26-11-9-21(10-12-26)8-7-17-3-1-2-4-19(17)21/h1-8,13,27H,9-12,14-15H2 |
| InChIKey | RZLWTDODDPXMJK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-3-(trifluoromethyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-3-(trifluoromethyl)phenyl]methanol?
The IUPAC name of [4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-3-(trifluoromethyl)phenyl]methanol (CID 70926920) is [4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-3-(trifluoromethyl)phenyl]methanol.
What is the SMILES notation for [4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-3-(trifluoromethyl)phenyl]methanol?
The canonical SMILES for [4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-3-(trifluoromethyl)phenyl]methanol is OCc1ccc(CN2CCC3(C=Cc4ccccc43)CC2)c(C(F)(F)F)c1.
What is the InChIKey of [4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-3-(trifluoromethyl)phenyl]methanol?
The InChIKey is RZLWTDODDPXMJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22F3NO/c23-22(24,25)20-13-16(15-27)5-6-18(20)14-26-11-9-21(10-12-26)8-7-17-3-1-2-4-19(17)21/h1-8,13,27H,9-12,14-15H2.
What are the key properties of [4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-3-(trifluoromethyl)phenyl]methanol?
[4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-3-(trifluoromethyl)phenyl]methanol has a molecular weight of 373.42 g/mol, XLogP of 4.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)-3-(trifluoromethyl)phenyl]methanol is sourced from PubChem (CID 70926920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).