About 2-(cyclopropylmethyl)-3,4-dihydroisoquinolin-1-one
2-(cyclopropylmethyl)-3,4-dihydroisoquinolin-1-one (PubChem CID 70927083) has the molecular formula C13H15NO
and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-3,4-dihydroisoquinolin-1-one.
Molecular Properties
| Compound Name | 2-(cyclopropylmethyl)-3,4-dihydroisoquinolin-1-one |
| PubChem CID | 70927083 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 2-(cyclopropylmethyl)-3,4-dihydroisoquinolin-1-one |
| SMILES | O=C1c2ccccc2CCN1CC1CC1 |
| InChI | InChI=1S/C13H15NO/c15-13-12-4-2-1-3-11(12)7-8-14(13)9-10-5-6-10/h1-4,10H,5-9H2 |
| InChIKey | BJLXWVQEDQLLIY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(cyclopropylmethyl)-3,4-dihydroisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopropylmethyl)-3,4-dihydroisoquinolin-1-one?
The IUPAC name of 2-(cyclopropylmethyl)-3,4-dihydroisoquinolin-1-one (CID 70927083) is 2-(cyclopropylmethyl)-3,4-dihydroisoquinolin-1-one.
What is the SMILES notation for 2-(cyclopropylmethyl)-3,4-dihydroisoquinolin-1-one?
The canonical SMILES for 2-(cyclopropylmethyl)-3,4-dihydroisoquinolin-1-one is O=C1c2ccccc2CCN1CC1CC1.
What is the InChIKey of 2-(cyclopropylmethyl)-3,4-dihydroisoquinolin-1-one?
The InChIKey is BJLXWVQEDQLLIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO/c15-13-12-4-2-1-3-11(12)7-8-14(13)9-10-5-6-10/h1-4,10H,5-9H2.
What are the key properties of 2-(cyclopropylmethyl)-3,4-dihydroisoquinolin-1-one?
2-(cyclopropylmethyl)-3,4-dihydroisoquinolin-1-one has a molecular weight of 201.27 g/mol, XLogP of 2.09, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopropylmethyl)-3,4-dihydroisoquinolin-1-one is sourced from PubChem (CID 70927083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).