C15H16FN5O3S — CID 70927180
(2S,3S,4R,5R)-2-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-5-(hydroxymethyl)-3-methyloxolan-3-ol (PubChem CID 70927180) has the molecular formula C15H16FN5O3S and a molecular weight of 365.39 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-5-(hydroxymethyl)-3-methyloxolan-3-ol.
| Compound Name | (2S,3S,4R,5R)-2-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-5-(hydroxymethyl)-3-methyloxolan-3-ol |
|---|---|
| PubChem CID | 70927180 |
| Molecular Formula | C15H16FN5O3S |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | (2S,3S,4R,5R)-2-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-5-(hydroxymethyl)-3-methyloxolan-3-ol |
| SMILES | C[C@@]1(O)[C@H](F)[C@@H](CO)O[C@H]1c1cc(-c2nccs2)c2c(N)ncnn12 |
| InChI | InChI=1S/C15H16FN5O3S/c1-15(23)11(16)9(5-22)24-12(15)8-4-7(14-18-2-3-25-14)10-13(17)19-6-20-21(8)10/h2-4,6,9,11-12,22-23H,5H2,1H3,(H2,17,19,20)/t9-,11-,12+,15-/m1/s1 |
| InChIKey | VMACCTOTRUTQQE-ADGXKJENSA-N |
| XLogP | 0.96 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |