C15H16FN5O2S — CID 70927183
[(2S,4R,5S)-5-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-4-methyloxolan-2-yl]methanol (PubChem CID 70927183) has the molecular formula C15H16FN5O2S and a molecular weight of 349.39 g/mol. Its IUPAC name is [(2S,4R,5S)-5-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-4-methyloxolan-2-yl]methanol.
| Compound Name | [(2S,4R,5S)-5-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-4-methyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 70927183 |
| Molecular Formula | C15H16FN5O2S |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | [(2S,4R,5S)-5-[4-amino-5-(1,3-thiazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-4-methyloxolan-2-yl]methanol |
| SMILES | C[C@@]1(F)C[C@@H](CO)O[C@H]1c1cc(-c2nccs2)c2c(N)ncnn12 |
| InChI | InChI=1S/C15H16FN5O2S/c1-15(16)5-8(6-22)23-12(15)10-4-9(14-18-2-3-24-14)11-13(17)19-7-20-21(10)11/h2-4,7-8,12,22H,5-6H2,1H3,(H2,17,19,20)/t8-,12-,15+/m0/s1 |
| InChIKey | YPFSKWSGLASMGW-KKUKJKQGSA-N |
| XLogP | 1.99 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |