C14H16FN7O3 — CID 70927184
(2R,3R,4R,5S)-5-[4-amino-5-(2H-triazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 70927184) has the molecular formula C14H16FN7O3 and a molecular weight of 349.33 g/mol. Its IUPAC name is (2R,3R,4R,5S)-5-[4-amino-5-(2H-triazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | (2R,3R,4R,5S)-5-[4-amino-5-(2H-triazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 70927184 |
| Molecular Formula | C14H16FN7O3 |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (2R,3R,4R,5S)-5-[4-amino-5-(2H-triazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | C[C@@]1(F)[C@H](O)[C@@H](CO)O[C@H]1c1cc(-c2cn[nH]n2)c2c(N)ncnn12 |
| InChI | InChI=1S/C14H16FN7O3/c1-14(15)11(24)9(4-23)25-12(14)8-2-6(7-3-18-21-20-7)10-13(16)17-5-19-22(8)10/h2-3,5,9,11-12,23-24H,4H2,1H3,(H2,16,17,19)(H,18,20,21)/t9-,11-,12+,14-/m1/s1 |
| InChIKey | RDRGLCRIEJISKL-SGESHTKJSA-N |
| XLogP | -0.38 |
| TPSA | 147.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |