C15H16FN5O4 — CID 70927186
(2R,3R,4R,5S)-5-[4-amino-5-(1,3-oxazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 70927186) has the molecular formula C15H16FN5O4 and a molecular weight of 349.32 g/mol. Its IUPAC name is (2R,3R,4R,5S)-5-[4-amino-5-(1,3-oxazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | (2R,3R,4R,5S)-5-[4-amino-5-(1,3-oxazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 70927186 |
| Molecular Formula | C15H16FN5O4 |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (2R,3R,4R,5S)-5-[4-amino-5-(1,3-oxazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | C[C@@]1(F)[C@H](O)[C@@H](CO)O[C@H]1c1cc(-c2ncco2)c2c(N)ncnn12 |
| InChI | InChI=1S/C15H16FN5O4/c1-15(16)11(23)9(5-22)25-12(15)8-4-7(14-18-2-3-24-14)10-13(17)19-6-20-21(8)10/h2-4,6,9,11-12,22-23H,5H2,1H3,(H2,17,19,20)/t9-,11-,12+,15-/m1/s1 |
| InChIKey | HNPOLFWUOUGEOI-ADGXKJENSA-N |
| XLogP | 0.49 |
| TPSA | 131.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |