C13H24N2O6 — CID 70927213
(4-propylpiperazin-1-yl)-[(2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methanone (PubChem CID 70927213) has the molecular formula C13H24N2O6 and a molecular weight of 304.34 g/mol. Its IUPAC name is (4-propylpiperazin-1-yl)-[(2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methanone.
| Compound Name | (4-propylpiperazin-1-yl)-[(2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methanone |
|---|---|
| PubChem CID | 70927213 |
| Molecular Formula | C13H24N2O6 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (4-propylpiperazin-1-yl)-[(2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methanone |
| SMILES | CCCN1CCN(C(=O)[C@H]2O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)CC1 |
| InChI | InChI=1S/C13H24N2O6/c1-2-3-14-4-6-15(7-5-14)12(19)11-9(17)8(16)10(18)13(20)21-11/h8-11,13,16-18,20H,2-7H2,1H3/t8-,9-,10+,11-,13+/m0/s1 |
| InChIKey | OJUNDEQLEAYMSV-XPORZQOISA-N |
| XLogP | -2.66 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |