C16H13I — CID 70927824
2-iodo-1,4,5,10b-tetrahydrofluoranthene (PubChem CID 70927824) has the molecular formula C16H13I and a molecular weight of 332.18 g/mol. Its IUPAC name is 2-iodo-1,4,5,10b-tetrahydrofluoranthene.
| Compound Name | 2-iodo-1,4,5,10b-tetrahydrofluoranthene |
|---|---|
| PubChem CID | 70927824 |
| Molecular Formula | C16H13I |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 2-iodo-1,4,5,10b-tetrahydrofluoranthene |
| SMILES | IC1=CC2=C3C(=CCC2)c2ccccc2C3C1 |
| InChI | InChI=1S/C16H13I/c17-11-8-10-4-3-7-14-12-5-1-2-6-13(12)15(9-11)16(10)14/h1-2,5-8,15H,3-4,9H2 |
| InChIKey | GVDNOAUGCSRLGN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|