C27H37N5O3 — CID 70928062
N-[[4-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-indol-3-yl]methyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 70928062) has the molecular formula C27H37N5O3 and a molecular weight of 479.63 g/mol. Its IUPAC name is N-[[4-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-indol-3-yl]methyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[[4-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-indol-3-yl]methyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 70928062 |
| Molecular Formula | C27H37N5O3 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | N-[[4-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-indol-3-yl]methyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCOc1ccc(-c2nc(-c3cccc4c3C(CNCCN(CC)CC)CN4)no2)cc1OCC |
| InChI | InChI=1S/C27H37N5O3/c1-5-32(6-2)15-14-28-17-20-18-29-22-11-9-10-21(25(20)22)26-30-27(35-31-26)19-12-13-23(33-7-3)24(16-19)34-8-4/h9-13,16,20,28-29H,5-8,14-15,17-18H2,1-4H3 |
| InChIKey | YBXWFGMPJVXIFD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 84.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|