C28H48N2+2 — CID 70928376
4-pentyl-1-[8-(4-pentyl-3,4-dihydropyridin-1-ium-1-yl)octyl]pyridin-1-ium (PubChem CID 70928376) has the molecular formula C28H48N2+2 and a molecular weight of 412.71 g/mol. Its IUPAC name is 4-pentyl-1-[8-(4-pentyl-3,4-dihydropyridin-1-ium-1-yl)octyl]pyridin-1-ium.
| Compound Name | 4-pentyl-1-[8-(4-pentyl-3,4-dihydropyridin-1-ium-1-yl)octyl]pyridin-1-ium |
|---|---|
| PubChem CID | 70928376 |
| Molecular Formula | C28H48N2+2 |
| Molecular Weight | 412.71 g/mol |
| Exact Mass | 412.38 |
| IUPAC Name | 4-pentyl-1-[8-(4-pentyl-3,4-dihydropyridin-1-ium-1-yl)octyl]pyridin-1-ium |
| SMILES | CCCCCc1cc[n+](CCCCCCCC[N+]2=CCC(CCCCC)C=C2)cc1 |
| InChI | InChI=1S/C28H48N2/c1-3-5-11-15-27-17-23-29(24-18-27)21-13-9-7-8-10-14-22-30-25-19-28(20-26-30)16-12-6-4-2/h17-19,23-26,28H,3-16,20-22H2,1-2H3/q+2 |
| InChIKey | RVMBZGHNGBJJFN-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 6.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.71 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|