C23H44OSi — CID 70928447
[(1Z,3aR,4S,7aS)-7a-methyl-1-(5-methylhexylidene)-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]oxy-triethylsilane (PubChem CID 70928447) has the molecular formula C23H44OSi and a molecular weight of 364.69 g/mol. Its IUPAC name is [(1Z,3aR,4S,7aS)-7a-methyl-1-(5-methylhexylidene)-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]oxy-triethylsilane.
| Compound Name | [(1Z,3aR,4S,7aS)-7a-methyl-1-(5-methylhexylidene)-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 70928447 |
| Molecular Formula | C23H44OSi |
| Molecular Weight | 364.69 g/mol |
| Exact Mass | 364.32 |
| IUPAC Name | [(1Z,3aR,4S,7aS)-7a-methyl-1-(5-methylhexylidene)-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCC[C@]2(C)/C(=C\CCCC(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C23H44OSi/c1-7-25(8-2,9-3)24-22-15-12-18-23(6)20(16-17-21(22)23)14-11-10-13-19(4)5/h14,19,21-22H,7-13,15-18H2,1-6H3/b20-14-/t21-,22-,23+/m0/s1 |
| InChIKey | ILAJTWFYNNNBJZ-ZNOKYQNTSA-N |
| XLogP | 7.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.69 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|