C16H21N5O — CID 70928517
6-methyl-2-N-[(4R)-4,7,8-trimethyl-2,3-dihydrochromen-4-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 70928517) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is 6-methyl-2-N-[(4R)-4,7,8-trimethyl-2,3-dihydrochromen-4-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-methyl-2-N-[(4R)-4,7,8-trimethyl-2,3-dihydrochromen-4-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 70928517 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 6-methyl-2-N-[(4R)-4,7,8-trimethyl-2,3-dihydrochromen-4-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1nc(N)nc(N[C@]2(C)CCOc3c2ccc(C)c3C)n1 |
| InChI | InChI=1S/C16H21N5O/c1-9-5-6-12-13(10(9)2)22-8-7-16(12,4)21-15-19-11(3)18-14(17)20-15/h5-6H,7-8H2,1-4H3,(H3,17,18,19,20,21)/t16-/m1/s1 |
| InChIKey | HPVHIAMDWVHLQL-MRXNPFEDSA-N |
| XLogP | 2.49 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |