C26H23FIN5O2 — CID 70928798
N-[1-[[1-benzyl-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]amino]-2-methyl-1-oxopropan-2-yl]-4-iodobenzamide (PubChem CID 70928798) has the molecular formula C26H23FIN5O2 and a molecular weight of 583.41 g/mol. Its IUPAC name is N-[1-[[1-benzyl-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]amino]-2-methyl-1-oxopropan-2-yl]-4-iodobenzamide.
| Compound Name | N-[1-[[1-benzyl-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]amino]-2-methyl-1-oxopropan-2-yl]-4-iodobenzamide |
|---|---|
| PubChem CID | 70928798 |
| Molecular Formula | C26H23FIN5O2 |
| Molecular Weight | 583.41 g/mol |
| Exact Mass | 583.09 |
| IUPAC Name | N-[1-[[1-benzyl-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]amino]-2-methyl-1-oxopropan-2-yl]-4-iodobenzamide |
| SMILES | CC(C)(NC(=O)c1ccc(I)cc1)C(=O)Nc1nc(-c2ccc(F)cc2)n(Cc2ccccc2)n1 |
| InChI | InChI=1S/C26H23FIN5O2/c1-26(2,31-23(34)19-10-14-21(28)15-11-19)24(35)30-25-29-22(18-8-12-20(27)13-9-18)33(32-25)16-17-6-4-3-5-7-17/h3-15H,16H2,1-2H3,(H,31,34)(H,30,32,35) |
| InChIKey | IJHVOAJLGVAFSN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|