C12H17NO2 — CID 70928838
(1R,2R,6S,7S)-4-propan-2-yl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 70928838) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (1R,2R,6S,7S)-4-propan-2-yl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2R,6S,7S)-4-propan-2-yl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 70928838 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (1R,2R,6S,7S)-4-propan-2-yl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CC(C)N1C(=O)[C@@H]2[C@@H]3CC[C@@H](C3)[C@@H]2C1=O |
| InChI | InChI=1S/C12H17NO2/c1-6(2)13-11(14)9-7-3-4-8(5-7)10(9)12(13)15/h6-10H,3-5H2,1-2H3/t7-,8+,9-,10+ |
| InChIKey | ZXFGYJLLCSYWLH-YNFQOJQRSA-N |
| XLogP | 1.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|