About (4-butoxy-3-methyl-3,4-dihydro-2H-pyran-2-yl)methanol
(4-butoxy-3-methyl-3,4-dihydro-2H-pyran-2-yl)methanol (PubChem CID 70929062) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is (4-butoxy-3-methyl-3,4-dihydro-2H-pyran-2-yl)methanol.
Molecular Properties
| Compound Name | (4-butoxy-3-methyl-3,4-dihydro-2H-pyran-2-yl)methanol |
| PubChem CID | 70929062 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (4-butoxy-3-methyl-3,4-dihydro-2H-pyran-2-yl)methanol |
| SMILES | CCCCOC1C=COC(CO)C1C |
| InChI | InChI=1S/C11H20O3/c1-3-4-6-13-10-5-7-14-11(8-12)9(10)2/h5,7,9-12H,3-4,6,8H2,1-2H3 |
| InChIKey | GBMCUMIXXPSIFJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-butoxy-3-methyl-3,4-dihydro-2H-pyran-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-butoxy-3-methyl-3,4-dihydro-2H-pyran-2-yl)methanol?
The IUPAC name of (4-butoxy-3-methyl-3,4-dihydro-2H-pyran-2-yl)methanol (CID 70929062) is (4-butoxy-3-methyl-3,4-dihydro-2H-pyran-2-yl)methanol.
What is the SMILES notation for (4-butoxy-3-methyl-3,4-dihydro-2H-pyran-2-yl)methanol?
The canonical SMILES for (4-butoxy-3-methyl-3,4-dihydro-2H-pyran-2-yl)methanol is CCCCOC1C=COC(CO)C1C.
What is the InChIKey of (4-butoxy-3-methyl-3,4-dihydro-2H-pyran-2-yl)methanol?
The InChIKey is GBMCUMIXXPSIFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-3-4-6-13-10-5-7-14-11(8-12)9(10)2/h5,7,9-12H,3-4,6,8H2,1-2H3.
What are the key properties of (4-butoxy-3-methyl-3,4-dihydro-2H-pyran-2-yl)methanol?
(4-butoxy-3-methyl-3,4-dihydro-2H-pyran-2-yl)methanol has a molecular weight of 200.28 g/mol, XLogP of 1.71, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-butoxy-3-methyl-3,4-dihydro-2H-pyran-2-yl)methanol is sourced from PubChem (CID 70929062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).