About 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclopropane
1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclopropane (PubChem CID 70929215) has the molecular formula C16H30O
and a molecular weight of 238.41 g/mol. Its IUPAC name is 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclopropane.
Molecular Properties
| Compound Name | 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclopropane |
| PubChem CID | 70929215 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclopropane |
| SMILES | CC(C)(C)/C=C/CCC1(COC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H30O/c1-14(2,3)9-7-8-10-16(11-12-16)13-17-15(4,5)6/h7,9H,8,10-13H2,1-6H3/b9-7+ |
| InChIKey | BVVYIFCXYGWDHH-VQHVLOKHSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclopropane?
The IUPAC name of 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclopropane (CID 70929215) is 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclopropane.
What is the SMILES notation for 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclopropane?
The canonical SMILES for 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclopropane is CC(C)(C)/C=C/CCC1(COC(C)(C)C)CC1.
What is the InChIKey of 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclopropane?
The InChIKey is BVVYIFCXYGWDHH-VQHVLOKHSA-N. The full InChI is InChI=1S/C16H30O/c1-14(2,3)9-7-8-10-16(11-12-16)13-17-15(4,5)6/h7,9H,8,10-13H2,1-6H3/b9-7+.
What are the key properties of 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclopropane?
1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclopropane has a molecular weight of 238.41 g/mol, XLogP of 4.96, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclopropane is sourced from PubChem (CID 70929215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).