About 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclobutane
1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclobutane (PubChem CID 70929234) has the molecular formula C17H32O
and a molecular weight of 252.44 g/mol. Its IUPAC name is 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclobutane.
Molecular Properties
| Compound Name | 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclobutane |
| PubChem CID | 70929234 |
| Molecular Formula | C17H32O |
| Molecular Weight | 252.44 g/mol |
| Exact Mass | 252.25 |
| IUPAC Name | 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclobutane |
| SMILES | CC(C)(C)/C=C/CCC1(COC(C)(C)C)CCC1 |
| InChI | InChI=1S/C17H32O/c1-15(2,3)10-7-8-11-17(12-9-13-17)14-18-16(4,5)6/h7,10H,8-9,11-14H2,1-6H3/b10-7+ |
| InChIKey | CSLUUVISKFTEBP-JXMROGBWSA-N |
| XLogP | 5.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclobutane?
The IUPAC name of 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclobutane (CID 70929234) is 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclobutane.
What is the SMILES notation for 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclobutane?
The canonical SMILES for 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclobutane is CC(C)(C)/C=C/CCC1(COC(C)(C)C)CCC1.
What is the InChIKey of 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclobutane?
The InChIKey is CSLUUVISKFTEBP-JXMROGBWSA-N. The full InChI is InChI=1S/C17H32O/c1-15(2,3)10-7-8-11-17(12-9-13-17)14-18-16(4,5)6/h7,10H,8-9,11-14H2,1-6H3/b10-7+.
What are the key properties of 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclobutane?
1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclobutane has a molecular weight of 252.44 g/mol, XLogP of 5.35, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-5,5-dimethylhex-3-enyl]-1-[(2-methylpropan-2-yl)oxymethyl]cyclobutane is sourced from PubChem (CID 70929234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).