C13H11BrN6O — CID 70929399
4-[(8-bromo-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]benzohydrazide (PubChem CID 70929399) has the molecular formula C13H11BrN6O and a molecular weight of 347.18 g/mol. Its IUPAC name is 4-[(8-bromo-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]benzohydrazide.
| Compound Name | 4-[(8-bromo-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]benzohydrazide |
|---|---|
| PubChem CID | 70929399 |
| Molecular Formula | C13H11BrN6O |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 4-[(8-bromo-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]benzohydrazide |
| SMILES | NNC(=O)c1ccc(Nc2nc3c(Br)cccn3n2)cc1 |
| InChI | InChI=1S/C13H11BrN6O/c14-10-2-1-7-20-11(10)17-13(19-20)16-9-5-3-8(4-6-9)12(21)18-15/h1-7H,15H2,(H,16,19)(H,18,21) |
| InChIKey | JZRKYIWRRQBJQU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|