C22H31F3O6 — CID 70929938
(4S,7R,8S,9S,10E,13E,16S)-16-acetyl-4,8-dihydroxy-5,5,7,9-tetramethyl-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione (PubChem CID 70929938) has the molecular formula C22H31F3O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is (4S,7R,8S,9S,10E,13E,16S)-16-acetyl-4,8-dihydroxy-5,5,7,9-tetramethyl-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,10E,13E,16S)-16-acetyl-4,8-dihydroxy-5,5,7,9-tetramethyl-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione |
|---|---|
| PubChem CID | 70929938 |
| Molecular Formula | C22H31F3O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | (4S,7R,8S,9S,10E,13E,16S)-16-acetyl-4,8-dihydroxy-5,5,7,9-tetramethyl-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione |
| SMILES | CC(=O)[C@@H]1C/C=C(/C(F)(F)F)C/C=C/[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C22H31F3O6/c1-12-7-6-8-15(22(23,24)25)9-10-16(14(3)26)31-18(28)11-17(27)21(4,5)20(30)13(2)19(12)29/h6-7,9,12-13,16-17,19,27,29H,8,10-11H2,1-5H3/b7-6+,15-9+/t12-,13+,16-,17-,19-/m0/s1 |
| InChIKey | NGHDUTWKLDRUEA-ZLXOKYJQSA-N |
| XLogP | 3.31 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|