C25H46O3 — CID 70930108
(Z,4S)-12-(2,5-dimethyl-1,3-dioxan-4-yl)-4,5,6,8,10,11-hexamethyltridec-7-en-2-one (PubChem CID 70930108) has the molecular formula C25H46O3 and a molecular weight of 394.64 g/mol. Its IUPAC name is (Z,4S)-12-(2,5-dimethyl-1,3-dioxan-4-yl)-4,5,6,8,10,11-hexamethyltridec-7-en-2-one.
| Compound Name | (Z,4S)-12-(2,5-dimethyl-1,3-dioxan-4-yl)-4,5,6,8,10,11-hexamethyltridec-7-en-2-one |
|---|---|
| PubChem CID | 70930108 |
| Molecular Formula | C25H46O3 |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.34 |
| IUPAC Name | (Z,4S)-12-(2,5-dimethyl-1,3-dioxan-4-yl)-4,5,6,8,10,11-hexamethyltridec-7-en-2-one |
| SMILES | CC(=O)C[C@H](C)C(C)C(C)/C=C(/C)CC(C)C(C)C(C)C1OC(C)OCC1C |
| InChI | InChI=1S/C25H46O3/c1-15(11-16(2)21(7)18(4)13-20(6)26)12-17(3)22(8)23(9)25-19(5)14-27-24(10)28-25/h11,16-19,21-25H,12-14H2,1-10H3/b15-11-/t16?,17?,18-,19?,21?,22?,23?,24?,25?/m0/s1 |
| InChIKey | NYLAOFHUDNPQGU-ZUIGAUGQSA-N |
| XLogP | 6.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|