About 2,4-dibromo-N-ethyl-1,3-thiazole-5-carboxamide
2,4-dibromo-N-ethyl-1,3-thiazole-5-carboxamide (PubChem CID 70930234) has the molecular formula C6H6Br2N2OS
and a molecular weight of 314.00 g/mol. Its IUPAC name is 2,4-dibromo-N-ethyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2,4-dibromo-N-ethyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 70930234 |
| Molecular Formula | C6H6Br2N2OS |
| Molecular Weight | 314.00 g/mol |
| Exact Mass | 311.86 |
| IUPAC Name | 2,4-dibromo-N-ethyl-1,3-thiazole-5-carboxamide |
| SMILES | CCNC(=O)c1sc(Br)nc1Br |
| InChI | InChI=1S/C6H6Br2N2OS/c1-2-9-5(11)3-4(7)10-6(8)12-3/h2H2,1H3,(H,9,11) |
| InChIKey | YGVQGWQYXNKDNZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.00 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dibromo-N-ethyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromo-N-ethyl-1,3-thiazole-5-carboxamide?
The IUPAC name of 2,4-dibromo-N-ethyl-1,3-thiazole-5-carboxamide (CID 70930234) is 2,4-dibromo-N-ethyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2,4-dibromo-N-ethyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2,4-dibromo-N-ethyl-1,3-thiazole-5-carboxamide is CCNC(=O)c1sc(Br)nc1Br.
What is the InChIKey of 2,4-dibromo-N-ethyl-1,3-thiazole-5-carboxamide?
The InChIKey is YGVQGWQYXNKDNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6Br2N2OS/c1-2-9-5(11)3-4(7)10-6(8)12-3/h2H2,1H3,(H,9,11).
What are the key properties of 2,4-dibromo-N-ethyl-1,3-thiazole-5-carboxamide?
2,4-dibromo-N-ethyl-1,3-thiazole-5-carboxamide has a molecular weight of 314.00 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-N-ethyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 70930234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).