C41H42N4OSSi — CID 70930328
trimethyl-[2-[[5-phenylsulfanyl-3-(1-tritylpyrazol-4-yl)-2,3-dihydropyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane (PubChem CID 70930328) has the molecular formula C41H42N4OSSi and a molecular weight of 666.97 g/mol. Its IUPAC name is trimethyl-[2-[[5-phenylsulfanyl-3-(1-tritylpyrazol-4-yl)-2,3-dihydropyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[5-phenylsulfanyl-3-(1-tritylpyrazol-4-yl)-2,3-dihydropyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 70930328 |
| Molecular Formula | C41H42N4OSSi |
| Molecular Weight | 666.97 g/mol |
| Exact Mass | 666.28 |
| IUPAC Name | trimethyl-[2-[[5-phenylsulfanyl-3-(1-tritylpyrazol-4-yl)-2,3-dihydropyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCN1CC(c2cnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c2)c2cc(Sc3ccccc3)cnc21 |
| InChI | InChI=1S/C41H42N4OSSi/c1-48(2,3)25-24-46-31-44-30-39(38-26-37(28-42-40(38)44)47-36-22-14-7-15-23-36)32-27-43-45(29-32)41(33-16-8-4-9-17-33,34-18-10-5-11-19-34)35-20-12-6-13-21-35/h4-23,26-29,39H,24-25,30-31H2,1-3H3 |
| InChIKey | GQCJGDDMYSSLNJ-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.97 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|