About (4-hydroxy-3,5-dimethylphenyl)phosphonic acid
(4-hydroxy-3,5-dimethylphenyl)phosphonic acid (PubChem CID 70930655) has the molecular formula C8H11O4P
and a molecular weight of 202.15 g/mol. Its IUPAC name is (4-hydroxy-3,5-dimethylphenyl)phosphonic acid.
Molecular Properties
| Compound Name | (4-hydroxy-3,5-dimethylphenyl)phosphonic acid |
| PubChem CID | 70930655 |
| Molecular Formula | C8H11O4P |
| Molecular Weight | 202.15 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | (4-hydroxy-3,5-dimethylphenyl)phosphonic acid |
| SMILES | Cc1cc(P(=O)(O)O)cc(C)c1O |
| InChI | InChI=1S/C8H11O4P/c1-5-3-7(13(10,11)12)4-6(2)8(5)9/h3-4,9H,1-2H3,(H2,10,11,12) |
| InChIKey | WUGUYDRZLHYDHC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.15 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxy-3,5-dimethylphenyl)phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-3,5-dimethylphenyl)phosphonic acid?
The IUPAC name of (4-hydroxy-3,5-dimethylphenyl)phosphonic acid (CID 70930655) is (4-hydroxy-3,5-dimethylphenyl)phosphonic acid.
What is the SMILES notation for (4-hydroxy-3,5-dimethylphenyl)phosphonic acid?
The canonical SMILES for (4-hydroxy-3,5-dimethylphenyl)phosphonic acid is Cc1cc(P(=O)(O)O)cc(C)c1O.
What is the InChIKey of (4-hydroxy-3,5-dimethylphenyl)phosphonic acid?
The InChIKey is WUGUYDRZLHYDHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11O4P/c1-5-3-7(13(10,11)12)4-6(2)8(5)9/h3-4,9H,1-2H3,(H2,10,11,12).
What are the key properties of (4-hydroxy-3,5-dimethylphenyl)phosphonic acid?
(4-hydroxy-3,5-dimethylphenyl)phosphonic acid has a molecular weight of 202.15 g/mol, XLogP of 0.81, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-3,5-dimethylphenyl)phosphonic acid is sourced from PubChem (CID 70930655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).