C32H40N5O7P — CID 70930723
4-[(4R,5S,6S,7R)-3-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]butoxymethyl dihydrogen phosphite (PubChem CID 70930723) has the molecular formula C32H40N5O7P and a molecular weight of 637.67 g/mol. Its IUPAC name is 4-[(4R,5S,6S,7R)-3-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]butoxymethyl dihydrogen phosphite.
| Compound Name | 4-[(4R,5S,6S,7R)-3-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]butoxymethyl dihydrogen phosphite |
|---|---|
| PubChem CID | 70930723 |
| Molecular Formula | C32H40N5O7P |
| Molecular Weight | 637.67 g/mol |
| Exact Mass | 637.27 |
| IUPAC Name | 4-[(4R,5S,6S,7R)-3-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]butoxymethyl dihydrogen phosphite |
| SMILES | Nc1n[nH]c2ccc(CN3C(=O)N(CCCCOCOP(O)O)[C@H](Cc4ccccc4)[C@H](O)[C@@H](O)[C@H]3Cc3ccccc3)cc12 |
| InChI | InChI=1S/C32H40N5O7P/c33-31-25-17-24(13-14-26(25)34-35-31)20-37-28(19-23-11-5-2-6-12-23)30(39)29(38)27(18-22-9-3-1-4-10-22)36(32(37)40)15-7-8-16-43-21-44-45(41)42/h1-6,9-14,17,27-30,38-39,41-42H,7-8,15-16,18-21H2,(H3,33,34,35)/t27-,28-,29+,30+/m1/s1 |
| InChIKey | JLNZYQVBYNBYQD-XAZDILKDSA-N |
| XLogP | 3.31 |
| TPSA | 177.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.67 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|