C30H37N3O4S — CID 70931104
(2R,3R)-N-[(4-benzyl-4,5-dihydro-1,3-thiazol-2-yl)methyl]-4-(1-cyclohexyl-3,4-dihydro-1H-isoquinolin-2-yl)-2,3-dihydroxy-4-oxobutanamide (PubChem CID 70931104) has the molecular formula C30H37N3O4S and a molecular weight of 535.71 g/mol. Its IUPAC name is (2R,3R)-N-[(4-benzyl-4,5-dihydro-1,3-thiazol-2-yl)methyl]-4-(1-cyclohexyl-3,4-dihydro-1H-isoquinolin-2-yl)-2,3-dihydroxy-4-oxobutanamide.
| Compound Name | (2R,3R)-N-[(4-benzyl-4,5-dihydro-1,3-thiazol-2-yl)methyl]-4-(1-cyclohexyl-3,4-dihydro-1H-isoquinolin-2-yl)-2,3-dihydroxy-4-oxobutanamide |
|---|---|
| PubChem CID | 70931104 |
| Molecular Formula | C30H37N3O4S |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | (2R,3R)-N-[(4-benzyl-4,5-dihydro-1,3-thiazol-2-yl)methyl]-4-(1-cyclohexyl-3,4-dihydro-1H-isoquinolin-2-yl)-2,3-dihydroxy-4-oxobutanamide |
| SMILES | O=C(NCC1=NC(Cc2ccccc2)CS1)[C@H](O)[C@@H](O)C(=O)N1CCc2ccccc2C1C1CCCCC1 |
| InChI | InChI=1S/C30H37N3O4S/c34-27(29(36)31-18-25-32-23(19-38-25)17-20-9-3-1-4-10-20)28(35)30(37)33-16-15-21-11-7-8-14-24(21)26(33)22-12-5-2-6-13-22/h1,3-4,7-11,14,22-23,26-28,34-35H,2,5-6,12-13,15-19H2,(H,31,36)/t23?,26?,27-,28-/m1/s1 |
| InChIKey | JOMJGFREFOFKMT-ZOSNSLACSA-N |
| XLogP | 3.29 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |