About 3-(benzenesulfonyl)-4-(3-piperidin-1-ylpropyl)-2,3-dihydro-1H-indole
3-(benzenesulfonyl)-4-(3-piperidin-1-ylpropyl)-2,3-dihydro-1H-indole (PubChem CID 70931130) has the molecular formula C22H28N2O2S
and a molecular weight of 384.54 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-4-(3-piperidin-1-ylpropyl)-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-4-(3-piperidin-1-ylpropyl)-2,3-dihydro-1H-indole |
| PubChem CID | 70931130 |
| Molecular Formula | C22H28N2O2S |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 3-(benzenesulfonyl)-4-(3-piperidin-1-ylpropyl)-2,3-dihydro-1H-indole |
| SMILES | O=S(=O)(c1ccccc1)C1CNc2cccc(CCCN3CCCCC3)c21 |
| InChI | InChI=1S/C22H28N2O2S/c25-27(26,19-11-3-1-4-12-19)21-17-23-20-13-7-9-18(22(20)21)10-8-16-24-14-5-2-6-15-24/h1,3-4,7,9,11-13,21,23H,2,5-6,8,10,14-17H2 |
| InChIKey | MGVXRMZBHPVWOM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(benzenesulfonyl)-4-(3-piperidin-1-ylpropyl)-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-4-(3-piperidin-1-ylpropyl)-2,3-dihydro-1H-indole?
The IUPAC name of 3-(benzenesulfonyl)-4-(3-piperidin-1-ylpropyl)-2,3-dihydro-1H-indole (CID 70931130) is 3-(benzenesulfonyl)-4-(3-piperidin-1-ylpropyl)-2,3-dihydro-1H-indole.
What is the SMILES notation for 3-(benzenesulfonyl)-4-(3-piperidin-1-ylpropyl)-2,3-dihydro-1H-indole?
The canonical SMILES for 3-(benzenesulfonyl)-4-(3-piperidin-1-ylpropyl)-2,3-dihydro-1H-indole is O=S(=O)(c1ccccc1)C1CNc2cccc(CCCN3CCCCC3)c21.
What is the InChIKey of 3-(benzenesulfonyl)-4-(3-piperidin-1-ylpropyl)-2,3-dihydro-1H-indole?
The InChIKey is MGVXRMZBHPVWOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O2S/c25-27(26,19-11-3-1-4-12-19)21-17-23-20-13-7-9-18(22(20)21)10-8-16-24-14-5-2-6-15-24/h1,3-4,7,9,11-13,21,23H,2,5-6,8,10,14-17H2.
What are the key properties of 3-(benzenesulfonyl)-4-(3-piperidin-1-ylpropyl)-2,3-dihydro-1H-indole?
3-(benzenesulfonyl)-4-(3-piperidin-1-ylpropyl)-2,3-dihydro-1H-indole has a molecular weight of 384.54 g/mol, XLogP of 4.05, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-4-(3-piperidin-1-ylpropyl)-2,3-dihydro-1H-indole is sourced from PubChem (CID 70931130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).