About 1-[(2R,5S)-4-(1-tert-butylpiperidin-4-yl)-5-methylmorpholin-2-yl]-N,N-dimethylmethanamine
1-[(2R,5S)-4-(1-tert-butylpiperidin-4-yl)-5-methylmorpholin-2-yl]-N,N-dimethylmethanamine (PubChem CID 70931693) has the molecular formula C17H35N3O
and a molecular weight of 297.49 g/mol. Its IUPAC name is 1-[(2R,5S)-4-(1-tert-butylpiperidin-4-yl)-5-methylmorpholin-2-yl]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-[(2R,5S)-4-(1-tert-butylpiperidin-4-yl)-5-methylmorpholin-2-yl]-N,N-dimethylmethanamine |
| PubChem CID | 70931693 |
| Molecular Formula | C17H35N3O |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.28 |
| IUPAC Name | 1-[(2R,5S)-4-(1-tert-butylpiperidin-4-yl)-5-methylmorpholin-2-yl]-N,N-dimethylmethanamine |
| SMILES | C[C@H]1CO[C@H](CN(C)C)CN1C1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C17H35N3O/c1-14-13-21-16(11-18(5)6)12-20(14)15-7-9-19(10-8-15)17(2,3)4/h14-16H,7-13H2,1-6H3/t14-,16+/m0/s1 |
| InChIKey | FLMDQOMEYMYFMY-GOEBONIOSA-N |
| XLogP | 1.90 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2R,5S)-4-(1-tert-butylpiperidin-4-yl)-5-methylmorpholin-2-yl]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R,5S)-4-(1-tert-butylpiperidin-4-yl)-5-methylmorpholin-2-yl]-N,N-dimethylmethanamine?
The IUPAC name of 1-[(2R,5S)-4-(1-tert-butylpiperidin-4-yl)-5-methylmorpholin-2-yl]-N,N-dimethylmethanamine (CID 70931693) is 1-[(2R,5S)-4-(1-tert-butylpiperidin-4-yl)-5-methylmorpholin-2-yl]-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[(2R,5S)-4-(1-tert-butylpiperidin-4-yl)-5-methylmorpholin-2-yl]-N,N-dimethylmethanamine?
The canonical SMILES for 1-[(2R,5S)-4-(1-tert-butylpiperidin-4-yl)-5-methylmorpholin-2-yl]-N,N-dimethylmethanamine is C[C@H]1CO[C@H](CN(C)C)CN1C1CCN(C(C)(C)C)CC1.
What is the InChIKey of 1-[(2R,5S)-4-(1-tert-butylpiperidin-4-yl)-5-methylmorpholin-2-yl]-N,N-dimethylmethanamine?
The InChIKey is FLMDQOMEYMYFMY-GOEBONIOSA-N. The full InChI is InChI=1S/C17H35N3O/c1-14-13-21-16(11-18(5)6)12-20(14)15-7-9-19(10-8-15)17(2,3)4/h14-16H,7-13H2,1-6H3/t14-,16+/m0/s1.
What are the key properties of 1-[(2R,5S)-4-(1-tert-butylpiperidin-4-yl)-5-methylmorpholin-2-yl]-N,N-dimethylmethanamine?
1-[(2R,5S)-4-(1-tert-butylpiperidin-4-yl)-5-methylmorpholin-2-yl]-N,N-dimethylmethanamine has a molecular weight of 297.49 g/mol, XLogP of 1.90, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R,5S)-4-(1-tert-butylpiperidin-4-yl)-5-methylmorpholin-2-yl]-N,N-dimethylmethanamine is sourced from PubChem (CID 70931693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).