C31H46O3 — CID 70933073
(1-methylcyclohexyl) 5,7-diethyl-6-oxaheptacyclo[9.6.1.13,9.113,16.02,10.04,8.012,17]icosane-14-carboxylate (PubChem CID 70933073) has the molecular formula C31H46O3 and a molecular weight of 466.71 g/mol. Its IUPAC name is (1-methylcyclohexyl) 5,7-diethyl-6-oxaheptacyclo[9.6.1.13,9.113,16.02,10.04,8.012,17]icosane-14-carboxylate.
| Compound Name | (1-methylcyclohexyl) 5,7-diethyl-6-oxaheptacyclo[9.6.1.13,9.113,16.02,10.04,8.012,17]icosane-14-carboxylate |
|---|---|
| PubChem CID | 70933073 |
| Molecular Formula | C31H46O3 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.34 |
| IUPAC Name | (1-methylcyclohexyl) 5,7-diethyl-6-oxaheptacyclo[9.6.1.13,9.113,16.02,10.04,8.012,17]icosane-14-carboxylate |
| SMILES | CCC1OC(CC)C2C3CC(C12)C1C2CC(C4C5CC(CC5C(=O)OC5(C)CCCCC5)C24)C31 |
| InChI | InChI=1S/C31H46O3/c1-4-22-28-20-14-21(29(28)23(5-2)33-22)27-19-13-18(26(20)27)24-15-11-16(25(19)24)17(12-15)30(32)34-31(3)9-7-6-8-10-31/h15-29H,4-14H2,1-3H3 |
| InChIKey | CWPQFRXDGVIKTL-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|