C31H43N7O5 — CID 70933084
2-[[4-[(9-cyclopentyl-5,7,7-trimethyl-6-oxo-8H-pyrimido[4,5-b][1,4]diazepin-2-yl)amino]-3-methoxybenzoyl]amino]ethyl (3R)-3-methylpyrrolidine-1-carboxylate (PubChem CID 70933084) has the molecular formula C31H43N7O5 and a molecular weight of 593.73 g/mol. Its IUPAC name is 2-[[4-[(9-cyclopentyl-5,7,7-trimethyl-6-oxo-8H-pyrimido[4,5-b][1,4]diazepin-2-yl)amino]-3-methoxybenzoyl]amino]ethyl (3R)-3-methylpyrrolidine-1-carboxylate.
| Compound Name | 2-[[4-[(9-cyclopentyl-5,7,7-trimethyl-6-oxo-8H-pyrimido[4,5-b][1,4]diazepin-2-yl)amino]-3-methoxybenzoyl]amino]ethyl (3R)-3-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70933084 |
| Molecular Formula | C31H43N7O5 |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.33 |
| IUPAC Name | 2-[[4-[(9-cyclopentyl-5,7,7-trimethyl-6-oxo-8H-pyrimido[4,5-b][1,4]diazepin-2-yl)amino]-3-methoxybenzoyl]amino]ethyl (3R)-3-methylpyrrolidine-1-carboxylate |
| SMILES | COc1cc(C(=O)NCCOC(=O)N2CC[C@@H](C)C2)ccc1Nc1ncc2c(n1)N(C1CCCC1)CC(C)(C)C(=O)N2C |
| InChI | InChI=1S/C31H43N7O5/c1-20-12-14-37(18-20)30(41)43-15-13-32-27(39)21-10-11-23(25(16-21)42-5)34-29-33-17-24-26(35-29)38(22-8-6-7-9-22)19-31(2,3)28(40)36(24)4/h10-11,16-17,20,22H,6-9,12-15,18-19H2,1-5H3,(H,32,39)(H,33,34,35)/t20-/m1/s1 |
| InChIKey | VAZOWXDZGAYFLY-HXUWFJFHSA-N |
| XLogP | 4.19 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|