C13H15BrCl2O3 — CID 70933192
4-[2-(4-bromo-2,5-dichlorophenoxy)ethyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 70933192) has the molecular formula C13H15BrCl2O3 and a molecular weight of 370.07 g/mol. Its IUPAC name is 4-[2-(4-bromo-2,5-dichlorophenoxy)ethyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-[2-(4-bromo-2,5-dichlorophenoxy)ethyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 70933192 |
| Molecular Formula | C13H15BrCl2O3 |
| Molecular Weight | 370.07 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | 4-[2-(4-bromo-2,5-dichlorophenoxy)ethyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OCC(CCOc2cc(Cl)c(Br)cc2Cl)O1 |
| InChI | InChI=1S/C13H15BrCl2O3/c1-13(2)18-7-8(19-13)3-4-17-12-6-10(15)9(14)5-11(12)16/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | CNFDGKUPTHZBAJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.07 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|