C21H24BrN3O3 — CID 70933267
3-[(6R)-3-[(1S)-1-(4-bromophenyl)ethyl]-2-oxo-6-phenyl-1,3-oxazinan-6-yl]propanehydrazide (PubChem CID 70933267) has the molecular formula C21H24BrN3O3 and a molecular weight of 446.35 g/mol. Its IUPAC name is 3-[(6R)-3-[(1S)-1-(4-bromophenyl)ethyl]-2-oxo-6-phenyl-1,3-oxazinan-6-yl]propanehydrazide.
| Compound Name | 3-[(6R)-3-[(1S)-1-(4-bromophenyl)ethyl]-2-oxo-6-phenyl-1,3-oxazinan-6-yl]propanehydrazide |
|---|---|
| PubChem CID | 70933267 |
| Molecular Formula | C21H24BrN3O3 |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 3-[(6R)-3-[(1S)-1-(4-bromophenyl)ethyl]-2-oxo-6-phenyl-1,3-oxazinan-6-yl]propanehydrazide |
| SMILES | C[C@@H](c1ccc(Br)cc1)N1CC[C@](CCC(=O)NN)(c2ccccc2)OC1=O |
| InChI | InChI=1S/C21H24BrN3O3/c1-15(16-7-9-18(22)10-8-16)25-14-13-21(28-20(25)27,12-11-19(26)24-23)17-5-3-2-4-6-17/h2-10,15H,11-14,23H2,1H3,(H,24,26)/t15-,21+/m0/s1 |
| InChIKey | ISKAKPBSDSYPLP-YCRPNKLZSA-N |
| XLogP | 4.02 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|