C24H25N9O3S2 — CID 70933462
2-[2-[[2-[(1S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]amino]ethyl]-2-(2H-tetrazol-5-yl)-6,11-dithiatricyclo[8.3.0.03,7]trideca-1(10),3(7),4,12-tetraene-5,12-dicarboxamide (PubChem CID 70933462) has the molecular formula C24H25N9O3S2 and a molecular weight of 551.66 g/mol. Its IUPAC name is 2-[2-[[2-[(1S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]amino]ethyl]-2-(2H-tetrazol-5-yl)-6,11-dithiatricyclo[8.3.0.03,7]trideca-1(10),3(7),4,12-tetraene-5,12-dicarboxamide.
| Compound Name | 2-[2-[[2-[(1S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]amino]ethyl]-2-(2H-tetrazol-5-yl)-6,11-dithiatricyclo[8.3.0.03,7]trideca-1(10),3(7),4,12-tetraene-5,12-dicarboxamide |
|---|---|
| PubChem CID | 70933462 |
| Molecular Formula | C24H25N9O3S2 |
| Molecular Weight | 551.66 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | 2-[2-[[2-[(1S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]amino]ethyl]-2-(2H-tetrazol-5-yl)-6,11-dithiatricyclo[8.3.0.03,7]trideca-1(10),3(7),4,12-tetraene-5,12-dicarboxamide |
| SMILES | N#CC1C[C@@H]2C[C@@H]2N1C(=O)CNCCC1(c2nn[nH]n2)c2cc(C(N)=O)sc2CCc2sc(C(N)=O)cc21 |
| InChI | InChI=1S/C24H25N9O3S2/c25-9-12-5-11-6-15(11)33(12)20(34)10-28-4-3-24(23-29-31-32-30-23)13-7-18(21(26)35)37-16(13)1-2-17-14(24)8-19(38-17)22(27)36/h7-8,11-12,15,28H,1-6,10H2,(H2,26,35)(H2,27,36)(H,29,30,31,32)/t11-,12?,15+/m1/s1 |
| InChIKey | VJMAYSYWJGGYEV-YOMIOTDVSA-N |
| XLogP | 0.45 |
| TPSA | 196.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.66 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|