C34H30FN7O2S — CID 70934047
2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)anilino]-6-[2-fluoro-4-(furan-3-yl)phenyl]-8-(1,3-thiazol-2-ylmethyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 70934047) has the molecular formula C34H30FN7O2S and a molecular weight of 619.73 g/mol. Its IUPAC name is 2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)anilino]-6-[2-fluoro-4-(furan-3-yl)phenyl]-8-(1,3-thiazol-2-ylmethyl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)anilino]-6-[2-fluoro-4-(furan-3-yl)phenyl]-8-(1,3-thiazol-2-ylmethyl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 70934047 |
| Molecular Formula | C34H30FN7O2S |
| Molecular Weight | 619.73 g/mol |
| Exact Mass | 619.22 |
| IUPAC Name | 2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)anilino]-6-[2-fluoro-4-(furan-3-yl)phenyl]-8-(1,3-thiazol-2-ylmethyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1c(-c2ccc(-c3ccoc3)cc2F)cc2cnc(Nc3ccc(N4CCN5CCCC5C4)cc3)nc2n1Cc1nccs1 |
| InChI | InChI=1S/C34H30FN7O2S/c35-30-17-22(23-9-14-44-21-23)3-8-28(30)29-16-24-18-37-34(39-32(24)42(33(29)43)20-31-36-10-15-45-31)38-25-4-6-26(7-5-25)41-13-12-40-11-1-2-27(40)19-41/h3-10,14-18,21,27H,1-2,11-13,19-20H2,(H,37,38,39) |
| InChIKey | WWBSCYZBMYFKFS-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.73 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|